C24H43IO5Si — CID 71492080
[(1E,3S,4S)-1-iodo-2,4-dimethylhexa-1,5-dien-3-yl] (3R,6R,7S)-3-[tert-butyl(dimethyl)silyl]oxy-6,7-dihydroxy-6-methylnon-8-enoate (PubChem CID 71492080) has the molecular formula C24H43IO5Si and a molecular weight of 566.59 g/mol. Its IUPAC name is [(1E,3S,4S)-1-iodo-2,4-dimethylhexa-1,5-dien-3-yl] (3R,6R,7S)-3-[tert-butyl(dimethyl)silyl]oxy-6,7-dihydroxy-6-methylnon-8-enoate.
| Compound Name | [(1E,3S,4S)-1-iodo-2,4-dimethylhexa-1,5-dien-3-yl] (3R,6R,7S)-3-[tert-butyl(dimethyl)silyl]oxy-6,7-dihydroxy-6-methylnon-8-enoate |
|---|---|
| PubChem CID | 71492080 |
| Molecular Formula | C24H43IO5Si |
| Molecular Weight | 566.59 g/mol |
| Exact Mass | 566.19 |
| IUPAC Name | [(1E,3S,4S)-1-iodo-2,4-dimethylhexa-1,5-dien-3-yl] (3R,6R,7S)-3-[tert-butyl(dimethyl)silyl]oxy-6,7-dihydroxy-6-methylnon-8-enoate |
| SMILES | C=C[C@H](C)[C@H](OC(=O)C[C@@H](CC[C@@](C)(O)[C@@H](O)C=C)O[Si](C)(C)C(C)(C)C)/C(C)=C/I |
| InChI | InChI=1S/C24H43IO5Si/c1-11-17(3)22(18(4)16-25)29-21(27)15-19(30-31(9,10)23(5,6)7)13-14-24(8,28)20(26)12-2/h11-12,16-17,19-20,22,26,28H,1-2,13-15H2,3-10H3/b18-16+/t17-,19+,20-,22-,24+/m0/s1 |
| InChIKey | LOVYILMKYDBQTD-PZHIQLPPSA-N |
| XLogP | 5.92 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.59 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|