C18H27IO6 — CID 71492096
[(2S,3S,4E,6S,7R,10R)-7,10-dihydroxy-2-[(E)-1-iodoprop-1-en-2-yl]-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-6-yl] acetate (PubChem CID 71492096) has the molecular formula C18H27IO6 and a molecular weight of 466.31 g/mol. Its IUPAC name is [(2S,3S,4E,6S,7R,10R)-7,10-dihydroxy-2-[(E)-1-iodoprop-1-en-2-yl]-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-6-yl] acetate.
| Compound Name | [(2S,3S,4E,6S,7R,10R)-7,10-dihydroxy-2-[(E)-1-iodoprop-1-en-2-yl]-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-6-yl] acetate |
|---|---|
| PubChem CID | 71492096 |
| Molecular Formula | C18H27IO6 |
| Molecular Weight | 466.31 g/mol |
| Exact Mass | 466.09 |
| IUPAC Name | [(2S,3S,4E,6S,7R,10R)-7,10-dihydroxy-2-[(E)-1-iodoprop-1-en-2-yl]-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-6-yl] acetate |
| SMILES | CC(=O)O[C@H]1/C=C/[C@H](C)[C@@H](/C(C)=C/I)OC(=O)C[C@H](O)CC[C@@]1(C)O |
| InChI | InChI=1S/C18H27IO6/c1-11-5-6-15(24-13(3)20)18(4,23)8-7-14(21)9-16(22)25-17(11)12(2)10-19/h5-6,10-11,14-15,17,21,23H,7-9H2,1-4H3/b6-5+,12-10+/t11-,14+,15-,17-,18+/m0/s1 |
| InChIKey | SOQMPMPDUGKWRT-FUCCLIABSA-N |
| XLogP | 2.66 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.31 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|