C9H19NO3 — CID 71492099
(2R,3S)-N,3-dimethoxy-N,2-dimethylpentanamide (PubChem CID 71492099) has the molecular formula C9H19NO3 and a molecular weight of 189.25 g/mol. Its IUPAC name is (2R,3S)-N,3-dimethoxy-N,2-dimethylpentanamide.
| Compound Name | (2R,3S)-N,3-dimethoxy-N,2-dimethylpentanamide |
|---|---|
| PubChem CID | 71492099 |
| Molecular Formula | C9H19NO3 |
| Molecular Weight | 189.25 g/mol |
| Exact Mass | 189.14 |
| IUPAC Name | (2R,3S)-N,3-dimethoxy-N,2-dimethylpentanamide |
| SMILES | CC[C@H](OC)[C@@H](C)C(=O)N(C)OC |
| InChI | InChI=1S/C9H19NO3/c1-6-8(12-4)7(2)9(11)10(3)13-5/h7-8H,6H2,1-5H3/t7-,8+/m1/s1 |
| InChIKey | ODXBLAHYAYVQAQ-SFYZADRCSA-N |
| XLogP | 1.07 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.25 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|