C13H22O3 — CID 71492103
(1R,2R)-1-[(2R,3R)-3-[(2R,3S)-3-methoxypentan-2-yl]oxiran-2-yl]-2-methylbut-3-yn-1-ol (PubChem CID 71492103) has the molecular formula C13H22O3 and a molecular weight of 226.32 g/mol. Its IUPAC name is (1R,2R)-1-[(2R,3R)-3-[(2R,3S)-3-methoxypentan-2-yl]oxiran-2-yl]-2-methylbut-3-yn-1-ol.
| Compound Name | (1R,2R)-1-[(2R,3R)-3-[(2R,3S)-3-methoxypentan-2-yl]oxiran-2-yl]-2-methylbut-3-yn-1-ol |
|---|---|
| PubChem CID | 71492103 |
| Molecular Formula | C13H22O3 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.16 |
| IUPAC Name | (1R,2R)-1-[(2R,3R)-3-[(2R,3S)-3-methoxypentan-2-yl]oxiran-2-yl]-2-methylbut-3-yn-1-ol |
| SMILES | C#C[C@@H](C)[C@@H](O)[C@H]1O[C@@H]1[C@H](C)[C@H](CC)OC |
| InChI | InChI=1S/C13H22O3/c1-6-8(3)11(14)13-12(16-13)9(4)10(7-2)15-5/h1,8-14H,7H2,2-5H3/t8-,9-,10+,11-,12-,13-/m1/s1 |
| InChIKey | FZXIHFMNDXLVSV-OJEZURLMSA-N |
| XLogP | 1.45 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|