C15H17NO — CID 71492162
(1R,4R)-4-ethenyl-9-azatricyclo[7.5.0.01,6]tetradeca-2,6,13-trien-8-one (PubChem CID 71492162) has the molecular formula C15H17NO and a molecular weight of 227.31 g/mol. Its IUPAC name is (1R,4R)-4-ethenyl-9-azatricyclo[7.5.0.01,6]tetradeca-2,6,13-trien-8-one.
| Compound Name | (1R,4R)-4-ethenyl-9-azatricyclo[7.5.0.01,6]tetradeca-2,6,13-trien-8-one |
|---|---|
| PubChem CID | 71492162 |
| Molecular Formula | C15H17NO |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | (1R,4R)-4-ethenyl-9-azatricyclo[7.5.0.01,6]tetradeca-2,6,13-trien-8-one |
| SMILES | C=C[C@@H]1C=C[C@@]23C=CCCCN2C(=O)C=C3C1 |
| InChI | InChI=1S/C15H17NO/c1-2-12-6-8-15-7-4-3-5-9-16(15)14(17)11-13(15)10-12/h2,4,6-8,11-12H,1,3,5,9-10H2/t12-,15-/m1/s1 |
| InChIKey | CQBKOOVNTAVAGW-IUODEOHRSA-N |
| XLogP | 2.61 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|