About CID 71492231
CID 71492231 (PubChem CID 71492231) has the molecular formula C27H30F3NO4
and a molecular weight of 489.53 g/mol.
Molecular Properties
| Compound Name | CID 71492231 |
| PubChem CID | 71492231 |
| Molecular Formula | C27H30F3NO4 |
| Molecular Weight | 489.53 g/mol |
| Exact Mass | 489.21 |
| IUPAC Name | — |
| SMILES | CC(C)c1nc2c(c3c1[C@@H](c1ccc(C(F)(F)F)cc1)OC31CCOCC1)[C@@H](O)CC1(CC1)[C@H]2O |
| InChI | InChI=1S/C27H30F3NO4/c1-14(2)21-19-20(18-17(32)13-25(7-8-25)24(33)22(18)31-21)26(9-11-34-12-10-26)35-23(19)15-3-5-16(6-4-15)27(28,29)30/h3-6,14,17,23-24,32-33H,7-13H2,1-2H3/t17-,23+,24-/m0/s1 |
| InChIKey | WDDUXEUDMPMIPG-VWMXVWASSA-N |
| XLogP | 5.60 |
| TPSA | 71.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 489.53 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze CID 71492231 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 71492231?
The IUPAC name of CID 71492231 (CID 71492231) is not available.
What is the SMILES notation for CID 71492231?
The canonical SMILES for CID 71492231 is CC(C)c1nc2c(c3c1[C@@H](c1ccc(C(F)(F)F)cc1)OC31CCOCC1)[C@@H](O)CC1(CC1)[C@H]2O.
What is the InChIKey of CID 71492231?
The InChIKey is WDDUXEUDMPMIPG-VWMXVWASSA-N. The full InChI is InChI=1S/C27H30F3NO4/c1-14(2)21-19-20(18-17(32)13-25(7-8-25)24(33)22(18)31-21)26(9-11-34-12-10-26)35-23(19)15-3-5-16(6-4-15)27(28,29)30/h3-6,14,17,23-24,32-33H,7-13H2,1-2H3/t17-,23+,24-/m0/s1.
What are the key properties of CID 71492231?
CID 71492231 has a molecular weight of 489.53 g/mol, XLogP of 5.60, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 71492231 is sourced from PubChem (CID 71492231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).