C26H48O4Si2 — CID 71492312
(4aR,6R,8aR)-6-[tert-butyl(dimethyl)silyl]oxy-7-methyl-4-[tri(propan-2-yl)silyloxymethyl]-4a,5,6,8a-tetrahydrochromen-2-one (PubChem CID 71492312) has the molecular formula C26H48O4Si2 and a molecular weight of 480.84 g/mol. Its IUPAC name is (4aR,6R,8aR)-6-[tert-butyl(dimethyl)silyl]oxy-7-methyl-4-[tri(propan-2-yl)silyloxymethyl]-4a,5,6,8a-tetrahydrochromen-2-one.
| Compound Name | (4aR,6R,8aR)-6-[tert-butyl(dimethyl)silyl]oxy-7-methyl-4-[tri(propan-2-yl)silyloxymethyl]-4a,5,6,8a-tetrahydrochromen-2-one |
|---|---|
| PubChem CID | 71492312 |
| Molecular Formula | C26H48O4Si2 |
| Molecular Weight | 480.84 g/mol |
| Exact Mass | 480.31 |
| IUPAC Name | (4aR,6R,8aR)-6-[tert-butyl(dimethyl)silyl]oxy-7-methyl-4-[tri(propan-2-yl)silyloxymethyl]-4a,5,6,8a-tetrahydrochromen-2-one |
| SMILES | CC1=C[C@H]2OC(=O)C=C(CO[Si](C(C)C)(C(C)C)C(C)C)[C@H]2C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H48O4Si2/c1-17(2)32(18(3)4,19(5)6)28-16-21-14-25(27)29-24-13-20(7)23(15-22(21)24)30-31(11,12)26(8,9)10/h13-14,17-19,22-24H,15-16H2,1-12H3/t22-,23-,24-/m1/s1 |
| InChIKey | WZZRMNMVGVVSFF-WXFUMESZSA-N |
| XLogP | 7.39 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.84 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|