C19H14F6N6O — CID 71492987
(Z)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-N'-(5-methyl-2-pyridinyl)prop-2-enehydrazide (PubChem CID 71492987) has the molecular formula C19H14F6N6O and a molecular weight of 456.35 g/mol. Its IUPAC name is (Z)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-N'-(5-methyl-2-pyridinyl)prop-2-enehydrazide.
| Compound Name | (Z)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-N'-(5-methyl-2-pyridinyl)prop-2-enehydrazide |
|---|---|
| PubChem CID | 71492987 |
| Molecular Formula | C19H14F6N6O |
| Molecular Weight | 456.35 g/mol |
| Exact Mass | 456.11 |
| IUPAC Name | (Z)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-N'-(5-methyl-2-pyridinyl)prop-2-enehydrazide |
| SMILES | Cc1ccc(NNC(=O)/C=C\n2cnc(-c3cc(C(F)(F)F)cc(C(F)(F)F)c3)n2)nc1 |
| InChI | InChI=1S/C19H14F6N6O/c1-11-2-3-15(26-9-11)28-29-16(32)4-5-31-10-27-17(30-31)12-6-13(18(20,21)22)8-14(7-12)19(23,24)25/h2-10H,1H3,(H,26,28)(H,29,32)/b5-4- |
| InChIKey | PIYXBGVMDBZULU-PLNGDYQASA-N |
| XLogP | 4.30 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.35 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|