About 2-(3,5-difluorophenyl)-N'-hydroxy-3-(1H-indazol-5-yl)-5-propylbenzenecarboximidamide
2-(3,5-difluorophenyl)-N'-hydroxy-3-(1H-indazol-5-yl)-5-propylbenzenecarboximidamide (PubChem CID 71493105) has the molecular formula C23H20F2N4O
and a molecular weight of 406.44 g/mol. Its IUPAC name is 2-(3,5-difluorophenyl)-N'-hydroxy-3-(1H-indazol-5-yl)-5-propylbenzenecarboximidamide.
Molecular Properties
| Compound Name | 2-(3,5-difluorophenyl)-N'-hydroxy-3-(1H-indazol-5-yl)-5-propylbenzenecarboximidamide |
| PubChem CID | 71493105 |
| Molecular Formula | C23H20F2N4O |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | 2-(3,5-difluorophenyl)-N'-hydroxy-3-(1H-indazol-5-yl)-5-propylbenzenecarboximidamide |
| SMILES | CCCc1cc(/C(N)=N/O)c(-c2cc(F)cc(F)c2)c(-c2ccc3[nH]ncc3c2)c1 |
| InChI | InChI=1S/C23H20F2N4O/c1-2-3-13-6-19(14-4-5-21-16(8-14)12-27-28-21)22(20(7-13)23(26)29-30)15-9-17(24)11-18(25)10-15/h4-12,30H,2-3H2,1H3,(H2,26,29)(H,27,28) |
| InChIKey | QGORGOWPQYOYAY-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 87.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(3,5-difluorophenyl)-N'-hydroxy-3-(1H-indazol-5-yl)-5-propylbenzenecarboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,5-difluorophenyl)-N'-hydroxy-3-(1H-indazol-5-yl)-5-propylbenzenecarboximidamide?
The IUPAC name of 2-(3,5-difluorophenyl)-N'-hydroxy-3-(1H-indazol-5-yl)-5-propylbenzenecarboximidamide (CID 71493105) is 2-(3,5-difluorophenyl)-N'-hydroxy-3-(1H-indazol-5-yl)-5-propylbenzenecarboximidamide.
What is the SMILES notation for 2-(3,5-difluorophenyl)-N'-hydroxy-3-(1H-indazol-5-yl)-5-propylbenzenecarboximidamide?
The canonical SMILES for 2-(3,5-difluorophenyl)-N'-hydroxy-3-(1H-indazol-5-yl)-5-propylbenzenecarboximidamide is CCCc1cc(/C(N)=N/O)c(-c2cc(F)cc(F)c2)c(-c2ccc3[nH]ncc3c2)c1.
What is the InChIKey of 2-(3,5-difluorophenyl)-N'-hydroxy-3-(1H-indazol-5-yl)-5-propylbenzenecarboximidamide?
The InChIKey is QGORGOWPQYOYAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H20F2N4O/c1-2-3-13-6-19(14-4-5-21-16(8-14)12-27-28-21)22(20(7-13)23(26)29-30)15-9-17(24)11-18(25)10-15/h4-12,30H,2-3H2,1H3,(H2,26,29)(H,27,28).
What are the key properties of 2-(3,5-difluorophenyl)-N'-hydroxy-3-(1H-indazol-5-yl)-5-propylbenzenecarboximidamide?
2-(3,5-difluorophenyl)-N'-hydroxy-3-(1H-indazol-5-yl)-5-propylbenzenecarboximidamide has a molecular weight of 406.44 g/mol, XLogP of 5.22, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,5-difluorophenyl)-N'-hydroxy-3-(1H-indazol-5-yl)-5-propylbenzenecarboximidamide is sourced from PubChem (CID 71493105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).