C33H32FN5O2 — CID 71493179
10-(4-fluorophenyl)-3,3,6,6-tetramethyl-9-(7-methyltetrazolo[1,5-a]quinolin-4-yl)-4,5,7,9-tetrahydro-2H-acridine-1,8-dione (PubChem CID 71493179) has the molecular formula C33H32FN5O2 and a molecular weight of 549.65 g/mol. Its IUPAC name is 10-(4-fluorophenyl)-3,3,6,6-tetramethyl-9-(7-methyltetrazolo[1,5-a]quinolin-4-yl)-4,5,7,9-tetrahydro-2H-acridine-1,8-dione.
| Compound Name | 10-(4-fluorophenyl)-3,3,6,6-tetramethyl-9-(7-methyltetrazolo[1,5-a]quinolin-4-yl)-4,5,7,9-tetrahydro-2H-acridine-1,8-dione |
|---|---|
| PubChem CID | 71493179 |
| Molecular Formula | C33H32FN5O2 |
| Molecular Weight | 549.65 g/mol |
| Exact Mass | 549.25 |
| IUPAC Name | 10-(4-fluorophenyl)-3,3,6,6-tetramethyl-9-(7-methyltetrazolo[1,5-a]quinolin-4-yl)-4,5,7,9-tetrahydro-2H-acridine-1,8-dione |
| SMILES | Cc1ccc2c(c1)cc(C1C3=C(CC(C)(C)CC3=O)N(c3ccc(F)cc3)C3=C1C(=O)CC(C)(C)C3)c1nnnn12 |
| InChI | InChI=1S/C33H32FN5O2/c1-18-6-11-23-19(12-18)13-22(31-35-36-37-39(23)31)28-29-24(14-32(2,3)16-26(29)40)38(21-9-7-20(34)8-10-21)25-15-33(4,5)17-27(41)30(25)28/h6-13,28H,14-17H2,1-5H3 |
| InChIKey | XEYNOGOGCJWHPS-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 80.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.65 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |