C20H30N2O6P2 — CID 71493366
3,6-bis(diethoxyphosphorylmethyl)-4-phenylpyridazine (PubChem CID 71493366) has the molecular formula C20H30N2O6P2 and a molecular weight of 456.42 g/mol. Its IUPAC name is 3,6-bis(diethoxyphosphorylmethyl)-4-phenylpyridazine.
| Compound Name | 3,6-bis(diethoxyphosphorylmethyl)-4-phenylpyridazine |
|---|---|
| PubChem CID | 71493366 |
| Molecular Formula | C20H30N2O6P2 |
| Molecular Weight | 456.42 g/mol |
| Exact Mass | 456.16 |
| IUPAC Name | 3,6-bis(diethoxyphosphorylmethyl)-4-phenylpyridazine |
| SMILES | CCOP(=O)(Cc1cc(-c2ccccc2)c(CP(=O)(OCC)OCC)nn1)OCC |
| InChI | InChI=1S/C20H30N2O6P2/c1-5-25-29(23,26-6-2)15-18-14-19(17-12-10-9-11-13-17)20(22-21-18)16-30(24,27-7-3)28-8-4/h9-14H,5-8,15-16H2,1-4H3 |
| InChIKey | CYRIIOBOCKDYBR-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 96.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.42 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|