About (4-hydroxy-3,5-diphenyl-2-thiophen-2-ylphenyl)-(2-hydroxyphenyl)methanone
(4-hydroxy-3,5-diphenyl-2-thiophen-2-ylphenyl)-(2-hydroxyphenyl)methanone (PubChem CID 71493411) has the molecular formula C29H20O3S
and a molecular weight of 448.54 g/mol. Its IUPAC name is (4-hydroxy-3,5-diphenyl-2-thiophen-2-ylphenyl)-(2-hydroxyphenyl)methanone.
Molecular Properties
| Compound Name | (4-hydroxy-3,5-diphenyl-2-thiophen-2-ylphenyl)-(2-hydroxyphenyl)methanone |
| PubChem CID | 71493411 |
| Molecular Formula | C29H20O3S |
| Molecular Weight | 448.54 g/mol |
| Exact Mass | 448.11 |
| IUPAC Name | (4-hydroxy-3,5-diphenyl-2-thiophen-2-ylphenyl)-(2-hydroxyphenyl)methanone |
| SMILES | O=C(c1ccccc1O)c1cc(-c2ccccc2)c(O)c(-c2ccccc2)c1-c1cccs1 |
| InChI | InChI=1S/C29H20O3S/c30-24-15-8-7-14-21(24)28(31)23-18-22(19-10-3-1-4-11-19)29(32)26(20-12-5-2-6-13-20)27(23)25-16-9-17-33-25/h1-18,30,32H |
| InChIKey | BJLWLESFBNCWGW-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 448.54 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4-hydroxy-3,5-diphenyl-2-thiophen-2-ylphenyl)-(2-hydroxyphenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-hydroxy-3,5-diphenyl-2-thiophen-2-ylphenyl)-(2-hydroxyphenyl)methanone?
The IUPAC name of (4-hydroxy-3,5-diphenyl-2-thiophen-2-ylphenyl)-(2-hydroxyphenyl)methanone (CID 71493411) is (4-hydroxy-3,5-diphenyl-2-thiophen-2-ylphenyl)-(2-hydroxyphenyl)methanone.
What is the SMILES notation for (4-hydroxy-3,5-diphenyl-2-thiophen-2-ylphenyl)-(2-hydroxyphenyl)methanone?
The canonical SMILES for (4-hydroxy-3,5-diphenyl-2-thiophen-2-ylphenyl)-(2-hydroxyphenyl)methanone is O=C(c1ccccc1O)c1cc(-c2ccccc2)c(O)c(-c2ccccc2)c1-c1cccs1.
What is the InChIKey of (4-hydroxy-3,5-diphenyl-2-thiophen-2-ylphenyl)-(2-hydroxyphenyl)methanone?
The InChIKey is BJLWLESFBNCWGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H20O3S/c30-24-15-8-7-14-21(24)28(31)23-18-22(19-10-3-1-4-11-19)29(32)26(20-12-5-2-6-13-20)27(23)25-16-9-17-33-25/h1-18,30,32H.
What are the key properties of (4-hydroxy-3,5-diphenyl-2-thiophen-2-ylphenyl)-(2-hydroxyphenyl)methanone?
(4-hydroxy-3,5-diphenyl-2-thiophen-2-ylphenyl)-(2-hydroxyphenyl)methanone has a molecular weight of 448.54 g/mol, XLogP of 7.39, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-hydroxy-3,5-diphenyl-2-thiophen-2-ylphenyl)-(2-hydroxyphenyl)methanone is sourced from PubChem (CID 71493411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).