C22H16ClNO — CID 71493414
7-chloro-2-methyl-3,4-diphenylisoquinolin-1-one (PubChem CID 71493414) has the molecular formula C22H16ClNO and a molecular weight of 345.83 g/mol. Its IUPAC name is 7-chloro-2-methyl-3,4-diphenylisoquinolin-1-one.
| Compound Name | 7-chloro-2-methyl-3,4-diphenylisoquinolin-1-one |
|---|---|
| PubChem CID | 71493414 |
| Molecular Formula | C22H16ClNO |
| Molecular Weight | 345.83 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | 7-chloro-2-methyl-3,4-diphenylisoquinolin-1-one |
| SMILES | Cn1c(-c2ccccc2)c(-c2ccccc2)c2ccc(Cl)cc2c1=O |
| InChI | InChI=1S/C22H16ClNO/c1-24-21(16-10-6-3-7-11-16)20(15-8-4-2-5-9-15)18-13-12-17(23)14-19(18)22(24)25/h2-14H,1H3 |
| InChIKey | UHKKXLSKHVJYHF-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.83 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |