C16H11F7N4O — CID 71493499
(Z)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-1-(3-fluoroazetidin-1-yl)prop-2-en-1-one (PubChem CID 71493499) has the molecular formula C16H11F7N4O and a molecular weight of 408.28 g/mol. Its IUPAC name is (Z)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-1-(3-fluoroazetidin-1-yl)prop-2-en-1-one.
| Compound Name | (Z)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-1-(3-fluoroazetidin-1-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 71493499 |
| Molecular Formula | C16H11F7N4O |
| Molecular Weight | 408.28 g/mol |
| Exact Mass | 408.08 |
| IUPAC Name | (Z)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-1-(3-fluoroazetidin-1-yl)prop-2-en-1-one |
| SMILES | O=C(/C=C\n1cnc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)n1)N1CC(F)C1 |
| InChI | InChI=1S/C16H11F7N4O/c17-12-6-26(7-12)13(28)1-2-27-8-24-14(25-27)9-3-10(15(18,19)20)5-11(4-9)16(21,22)23/h1-5,8,12H,6-7H2/b2-1- |
| InChIKey | MQHFRPVHGAJNJN-UPHRSURJSA-N |
| XLogP | 3.63 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.28 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|