C29H20N4O6 — CID 71493868
dimethyl 9,9-dicyano-8-(3-nitrophenyl)-8,9a-dihydropyrido[1,2-f]phenanthridine-6,7-dicarboxylate (PubChem CID 71493868) has the molecular formula C29H20N4O6 and a molecular weight of 520.50 g/mol. Its IUPAC name is dimethyl 9,9-dicyano-8-(3-nitrophenyl)-8,9a-dihydropyrido[1,2-f]phenanthridine-6,7-dicarboxylate.
| Compound Name | dimethyl 9,9-dicyano-8-(3-nitrophenyl)-8,9a-dihydropyrido[1,2-f]phenanthridine-6,7-dicarboxylate |
|---|---|
| PubChem CID | 71493868 |
| Molecular Formula | C29H20N4O6 |
| Molecular Weight | 520.50 g/mol |
| Exact Mass | 520.14 |
| IUPAC Name | dimethyl 9,9-dicyano-8-(3-nitrophenyl)-8,9a-dihydropyrido[1,2-f]phenanthridine-6,7-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N2c3ccccc3-c3ccccc3C2C(C#N)(C#N)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C29H20N4O6/c1-38-27(34)23-24(17-8-7-9-18(14-17)33(36)37)29(15-30,16-31)26-21-12-4-3-10-19(21)20-11-5-6-13-22(20)32(26)25(23)28(35)39-2/h3-14,24,26H,1-2H3 |
| InChIKey | DPAXEFQFXYPURT-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 146.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.50 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|