C31H24N4O6 — CID 71493869
diethyl 9,9-dicyano-8-(4-nitrophenyl)-8,9a-dihydropyrido[1,2-f]phenanthridine-6,7-dicarboxylate (PubChem CID 71493869) has the molecular formula C31H24N4O6 and a molecular weight of 548.56 g/mol. Its IUPAC name is diethyl 9,9-dicyano-8-(4-nitrophenyl)-8,9a-dihydropyrido[1,2-f]phenanthridine-6,7-dicarboxylate.
| Compound Name | diethyl 9,9-dicyano-8-(4-nitrophenyl)-8,9a-dihydropyrido[1,2-f]phenanthridine-6,7-dicarboxylate |
|---|---|
| PubChem CID | 71493869 |
| Molecular Formula | C31H24N4O6 |
| Molecular Weight | 548.56 g/mol |
| Exact Mass | 548.17 |
| IUPAC Name | diethyl 9,9-dicyano-8-(4-nitrophenyl)-8,9a-dihydropyrido[1,2-f]phenanthridine-6,7-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C(=O)OCC)N2c3ccccc3-c3ccccc3C2C(C#N)(C#N)C1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C31H24N4O6/c1-3-40-29(36)25-26(19-13-15-20(16-14-19)35(38)39)31(17-32,18-33)28-23-11-6-5-9-21(23)22-10-7-8-12-24(22)34(28)27(25)30(37)41-4-2/h5-16,26,28H,3-4H2,1-2H3 |
| InChIKey | HOWBPCNNGTWDAC-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 146.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.56 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|