C24H31N5S — CID 71493914
N'-[4-[[4-(5-tert-butylpyrazin-2-yl)-1,3-thiazol-2-yl]methyl]-2,5-dimethylphenyl]-N-ethyl-N-methylmethanimidamide (PubChem CID 71493914) has the molecular formula C24H31N5S and a molecular weight of 421.61 g/mol. Its IUPAC name is N'-[4-[[4-(5-tert-butylpyrazin-2-yl)-1,3-thiazol-2-yl]methyl]-2,5-dimethylphenyl]-N-ethyl-N-methylmethanimidamide.
| Compound Name | N'-[4-[[4-(5-tert-butylpyrazin-2-yl)-1,3-thiazol-2-yl]methyl]-2,5-dimethylphenyl]-N-ethyl-N-methylmethanimidamide |
|---|---|
| PubChem CID | 71493914 |
| Molecular Formula | C24H31N5S |
| Molecular Weight | 421.61 g/mol |
| Exact Mass | 421.23 |
| IUPAC Name | N'-[4-[[4-(5-tert-butylpyrazin-2-yl)-1,3-thiazol-2-yl]methyl]-2,5-dimethylphenyl]-N-ethyl-N-methylmethanimidamide |
| SMILES | CCN(C)/C=N/c1cc(C)c(Cc2nc(-c3cnc(C(C)(C)C)cn3)cs2)cc1C |
| InChI | InChI=1S/C24H31N5S/c1-8-29(7)15-27-19-10-16(2)18(9-17(19)3)11-23-28-21(14-30-23)20-12-26-22(13-25-20)24(4,5)6/h9-10,12-15H,8,11H2,1-7H3/b27-15+ |
| InChIKey | AZVFHBSDINQCRR-JFLMPSFJSA-N |
| XLogP | 5.72 |
| TPSA | 54.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.61 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|