C21H15F6N5O — CID 71493957
(Z)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-1-(3-pyridin-2-ylazetidin-1-yl)prop-2-en-1-one (PubChem CID 71493957) has the molecular formula C21H15F6N5O and a molecular weight of 467.37 g/mol. Its IUPAC name is (Z)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-1-(3-pyridin-2-ylazetidin-1-yl)prop-2-en-1-one.
| Compound Name | (Z)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-1-(3-pyridin-2-ylazetidin-1-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 71493957 |
| Molecular Formula | C21H15F6N5O |
| Molecular Weight | 467.37 g/mol |
| Exact Mass | 467.12 |
| IUPAC Name | (Z)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-1-(3-pyridin-2-ylazetidin-1-yl)prop-2-en-1-one |
| SMILES | O=C(/C=C\n1cnc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)n1)N1CC(c2ccccn2)C1 |
| InChI | InChI=1S/C21H15F6N5O/c22-20(23,24)15-7-13(8-16(9-15)21(25,26)27)19-29-12-32(30-19)6-4-18(33)31-10-14(11-31)17-3-1-2-5-28-17/h1-9,12,14H,10-11H2/b6-4- |
| InChIKey | KRKHUIWKDMPRSY-XQRVVYSFSA-N |
| XLogP | 4.47 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.37 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|