C24H29N3O2S2 — CID 71494077
N'-[2,5-dimethyl-4-[[4-[(4-methylphenyl)sulfonylmethyl]-1,3-thiazol-2-yl]methyl]phenyl]-N-ethyl-N-methylmethanimidamide (PubChem CID 71494077) has the molecular formula C24H29N3O2S2 and a molecular weight of 455.65 g/mol. Its IUPAC name is N'-[2,5-dimethyl-4-[[4-[(4-methylphenyl)sulfonylmethyl]-1,3-thiazol-2-yl]methyl]phenyl]-N-ethyl-N-methylmethanimidamide.
| Compound Name | N'-[2,5-dimethyl-4-[[4-[(4-methylphenyl)sulfonylmethyl]-1,3-thiazol-2-yl]methyl]phenyl]-N-ethyl-N-methylmethanimidamide |
|---|---|
| PubChem CID | 71494077 |
| Molecular Formula | C24H29N3O2S2 |
| Molecular Weight | 455.65 g/mol |
| Exact Mass | 455.17 |
| IUPAC Name | N'-[2,5-dimethyl-4-[[4-[(4-methylphenyl)sulfonylmethyl]-1,3-thiazol-2-yl]methyl]phenyl]-N-ethyl-N-methylmethanimidamide |
| SMILES | CCN(C)/C=N/c1cc(C)c(Cc2nc(CS(=O)(=O)c3ccc(C)cc3)cs2)cc1C |
| InChI | InChI=1S/C24H29N3O2S2/c1-6-27(5)16-25-23-12-18(3)20(11-19(23)4)13-24-26-21(14-30-24)15-31(28,29)22-9-7-17(2)8-10-22/h7-12,14,16H,6,13,15H2,1-5H3/b25-16+ |
| InChIKey | JHCQQQKPEWGVTB-PCLIKHOPSA-N |
| XLogP | 5.24 |
| TPSA | 62.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.65 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|