C13H16F3N3O4 — CID 71494638
2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl-(4-methyl-1,3-oxazol-5-yl)methanone;2,2,2-trifluoroacetic acid (PubChem CID 71494638) has the molecular formula C13H16F3N3O4 and a molecular weight of 335.28 g/mol. Its IUPAC name is 2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl-(4-methyl-1,3-oxazol-5-yl)methanone;2,2,2-trifluoroacetic acid.
| Compound Name | 2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl-(4-methyl-1,3-oxazol-5-yl)methanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 71494638 |
| Molecular Formula | C13H16F3N3O4 |
| Molecular Weight | 335.28 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | 2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl-(4-methyl-1,3-oxazol-5-yl)methanone;2,2,2-trifluoroacetic acid |
| SMILES | Cc1ncoc1C(=O)N1CC2CNCC2C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C11H15N3O2.C2HF3O2/c1-7-10(16-6-13-7)11(15)14-4-8-2-12-3-9(8)5-14;3-2(4,5)1(6)7/h6,8-9,12H,2-5H2,1H3;(H,6,7) |
| InChIKey | BZBVXHBLGYIXOT-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 95.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.28 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |