C31H37N9O — CID 71495147
6-[1-[3-(4,5-diphenyl-1,3-oxazol-2-yl)propyl]triazol-4-yl]-2-N,4-N-bis(2-methylpropyl)-1,3,5-triazine-2,4-diamine (PubChem CID 71495147) has the molecular formula C31H37N9O and a molecular weight of 551.70 g/mol. Its IUPAC name is 6-[1-[3-(4,5-diphenyl-1,3-oxazol-2-yl)propyl]triazol-4-yl]-2-N,4-N-bis(2-methylpropyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[1-[3-(4,5-diphenyl-1,3-oxazol-2-yl)propyl]triazol-4-yl]-2-N,4-N-bis(2-methylpropyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 71495147 |
| Molecular Formula | C31H37N9O |
| Molecular Weight | 551.70 g/mol |
| Exact Mass | 551.31 |
| IUPAC Name | 6-[1-[3-(4,5-diphenyl-1,3-oxazol-2-yl)propyl]triazol-4-yl]-2-N,4-N-bis(2-methylpropyl)-1,3,5-triazine-2,4-diamine |
| SMILES | CC(C)CNc1nc(NCC(C)C)nc(-c2cn(CCCc3nc(-c4ccccc4)c(-c4ccccc4)o3)nn2)n1 |
| InChI | InChI=1S/C31H37N9O/c1-21(2)18-32-30-35-29(36-31(37-30)33-19-22(3)4)25-20-40(39-38-25)17-11-16-26-34-27(23-12-7-5-8-13-23)28(41-26)24-14-9-6-10-15-24/h5-10,12-15,20-22H,11,16-19H2,1-4H3,(H2,32,33,35,36,37) |
| InChIKey | WGSXEEJWRVPBFT-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 119.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.70 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |