C27H29BFN3 — CID 71495382
4-(2-fluoro-4,6,10,12-tetramethyl-2-phenyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-8-yl)-N,N-dimethylaniline (PubChem CID 71495382) has the molecular formula C27H29BFN3 and a molecular weight of 425.36 g/mol. Its IUPAC name is 4-(2-fluoro-4,6,10,12-tetramethyl-2-phenyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-8-yl)-N,N-dimethylaniline.
| Compound Name | 4-(2-fluoro-4,6,10,12-tetramethyl-2-phenyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-8-yl)-N,N-dimethylaniline |
|---|---|
| PubChem CID | 71495382 |
| Molecular Formula | C27H29BFN3 |
| Molecular Weight | 425.36 g/mol |
| Exact Mass | 425.24 |
| IUPAC Name | 4-(2-fluoro-4,6,10,12-tetramethyl-2-phenyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-8-yl)-N,N-dimethylaniline |
| SMILES | CC1=CC(C)=[N+]2C1=C(c1ccc(N(C)C)cc1)c1c(C)cc(C)n1[B-]2(F)c1ccccc1 |
| InChI | InChI=1S/C27H29BFN3/c1-18-16-20(3)31-26(18)25(22-12-14-24(15-13-22)30(5)6)27-19(2)17-21(4)32(27)28(31,29)23-10-8-7-9-11-23/h7-17H,1-6H3 |
| InChIKey | IQDLGSOKHBQHHY-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 11.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.36 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|