C23H28N2O4 — CID 7149554
[2-[[(1R,2R)-2-methylcyclohexyl]amino]-2-oxoethyl] 2-(4-anilinophenoxy)acetate (PubChem CID 7149554) has the molecular formula C23H28N2O4 and a molecular weight of 396.49 g/mol. Its IUPAC name is [2-[[(1R,2R)-2-methylcyclohexyl]amino]-2-oxoethyl] 2-(4-anilinophenoxy)acetate.
| Compound Name | [2-[[(1R,2R)-2-methylcyclohexyl]amino]-2-oxoethyl] 2-(4-anilinophenoxy)acetate |
|---|---|
| PubChem CID | 7149554 |
| Molecular Formula | C23H28N2O4 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | [2-[[(1R,2R)-2-methylcyclohexyl]amino]-2-oxoethyl] 2-(4-anilinophenoxy)acetate |
| SMILES | C[C@@H]1CCCC[C@H]1NC(=O)COC(=O)COc1ccc(Nc2ccccc2)cc1 |
| InChI | InChI=1S/C23H28N2O4/c1-17-7-5-6-10-21(17)25-22(26)15-29-23(27)16-28-20-13-11-19(12-14-20)24-18-8-3-2-4-9-18/h2-4,8-9,11-14,17,21,24H,5-7,10,15-16H2,1H3,(H,25,26)/t17-,21-/m1/s1 |
| InChIKey | YHHXZZLBTFRIJM-DYESRHJHSA-N |
| XLogP | 4.05 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |