About 7-[(4-fluorophenyl)methoxy]-4,5-dihydrotetrazolo[1,5-a]quinoline
7-[(4-fluorophenyl)methoxy]-4,5-dihydrotetrazolo[1,5-a]quinoline (PubChem CID 71495546) has the molecular formula C16H13FN4O
and a molecular weight of 296.31 g/mol. Its IUPAC name is 7-[(4-fluorophenyl)methoxy]-4,5-dihydrotetrazolo[1,5-a]quinoline.
Molecular Properties
| Compound Name | 7-[(4-fluorophenyl)methoxy]-4,5-dihydrotetrazolo[1,5-a]quinoline |
| PubChem CID | 71495546 |
| Molecular Formula | C16H13FN4O |
| Molecular Weight | 296.31 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | 7-[(4-fluorophenyl)methoxy]-4,5-dihydrotetrazolo[1,5-a]quinoline |
| SMILES | Fc1ccc(COc2ccc3c(c2)CCc2nnnn2-3)cc1 |
| InChI | InChI=1S/C16H13FN4O/c17-13-4-1-11(2-5-13)10-22-14-6-7-15-12(9-14)3-8-16-18-19-20-21(15)16/h1-2,4-7,9H,3,8,10H2 |
| InChIKey | MSAPZSSRQHJGJT-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.31 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 7-[(4-fluorophenyl)methoxy]-4,5-dihydrotetrazolo[1,5-a]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[(4-fluorophenyl)methoxy]-4,5-dihydrotetrazolo[1,5-a]quinoline?
The IUPAC name of 7-[(4-fluorophenyl)methoxy]-4,5-dihydrotetrazolo[1,5-a]quinoline (CID 71495546) is 7-[(4-fluorophenyl)methoxy]-4,5-dihydrotetrazolo[1,5-a]quinoline.
What is the SMILES notation for 7-[(4-fluorophenyl)methoxy]-4,5-dihydrotetrazolo[1,5-a]quinoline?
The canonical SMILES for 7-[(4-fluorophenyl)methoxy]-4,5-dihydrotetrazolo[1,5-a]quinoline is Fc1ccc(COc2ccc3c(c2)CCc2nnnn2-3)cc1.
What is the InChIKey of 7-[(4-fluorophenyl)methoxy]-4,5-dihydrotetrazolo[1,5-a]quinoline?
The InChIKey is MSAPZSSRQHJGJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13FN4O/c17-13-4-1-11(2-5-13)10-22-14-6-7-15-12(9-14)3-8-16-18-19-20-21(15)16/h1-2,4-7,9H,3,8,10H2.
What are the key properties of 7-[(4-fluorophenyl)methoxy]-4,5-dihydrotetrazolo[1,5-a]quinoline?
7-[(4-fluorophenyl)methoxy]-4,5-dihydrotetrazolo[1,5-a]quinoline has a molecular weight of 296.31 g/mol, XLogP of 2.48, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[(4-fluorophenyl)methoxy]-4,5-dihydrotetrazolo[1,5-a]quinoline is sourced from PubChem (CID 71495546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).