C19H18O5 — CID 71495704
8-propyl-6,12-dihydrochromeno[2,3-c]chromene-2,3,9-triol (PubChem CID 71495704) has the molecular formula C19H18O5 and a molecular weight of 326.35 g/mol. Its IUPAC name is 8-propyl-6,12-dihydrochromeno[2,3-c]chromene-2,3,9-triol.
| Compound Name | 8-propyl-6,12-dihydrochromeno[2,3-c]chromene-2,3,9-triol |
|---|---|
| PubChem CID | 71495704 |
| Molecular Formula | C19H18O5 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 8-propyl-6,12-dihydrochromeno[2,3-c]chromene-2,3,9-triol |
| SMILES | CCCc1c(O)ccc2c1OC1=C(C2)c2cc(O)c(O)cc2OC1 |
| InChI | InChI=1S/C19H18O5/c1-2-3-11-14(20)5-4-10-6-12-13-7-15(21)16(22)8-17(13)23-9-18(12)24-19(10)11/h4-5,7-8,20-22H,2-3,6,9H2,1H3 |
| InChIKey | PLBKGBLUOXWNDU-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|