C24H33N5O3S — CID 71495833
methyl 2-[[2-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridine-3-carbonyl]amino]-4,5,6,7-tetrahydrothieno[2,3-c]pyridine-3-carboxylate (PubChem CID 71495833) has the molecular formula C24H33N5O3S and a molecular weight of 471.63 g/mol. Its IUPAC name is methyl 2-[[2-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridine-3-carbonyl]amino]-4,5,6,7-tetrahydrothieno[2,3-c]pyridine-3-carboxylate.
| Compound Name | methyl 2-[[2-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridine-3-carbonyl]amino]-4,5,6,7-tetrahydrothieno[2,3-c]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 71495833 |
| Molecular Formula | C24H33N5O3S |
| Molecular Weight | 471.63 g/mol |
| Exact Mass | 471.23 |
| IUPAC Name | methyl 2-[[2-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridine-3-carbonyl]amino]-4,5,6,7-tetrahydrothieno[2,3-c]pyridine-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)c2cccnc2NC2CC(C)(C)NC(C)(C)C2)sc2c1CCNC2 |
| InChI | InChI=1S/C24H33N5O3S/c1-23(2)11-14(12-24(3,4)29-23)27-19-16(7-6-9-26-19)20(30)28-21-18(22(31)32-5)15-8-10-25-13-17(15)33-21/h6-7,9,14,25,29H,8,10-13H2,1-5H3,(H,26,27)(H,28,30) |
| InChIKey | DGJBNDXYQZRGSS-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 104.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.63 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |