C20H19N7O4 — CID 71496074
2-[4-[2-acetyl-3-(4-nitrophenyl)-3,4-dihydropyrazol-5-yl]phenyl]-4-amino-5-methyl-1,2,4-triazol-3-one (PubChem CID 71496074) has the molecular formula C20H19N7O4 and a molecular weight of 421.42 g/mol. Its IUPAC name is 2-[4-[2-acetyl-3-(4-nitrophenyl)-3,4-dihydropyrazol-5-yl]phenyl]-4-amino-5-methyl-1,2,4-triazol-3-one.
| Compound Name | 2-[4-[2-acetyl-3-(4-nitrophenyl)-3,4-dihydropyrazol-5-yl]phenyl]-4-amino-5-methyl-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 71496074 |
| Molecular Formula | C20H19N7O4 |
| Molecular Weight | 421.42 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | 2-[4-[2-acetyl-3-(4-nitrophenyl)-3,4-dihydropyrazol-5-yl]phenyl]-4-amino-5-methyl-1,2,4-triazol-3-one |
| SMILES | CC(=O)N1N=C(c2ccc(-n3nc(C)n(N)c3=O)cc2)CC1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H19N7O4/c1-12-22-26(20(29)24(12)21)16-7-3-14(4-8-16)18-11-19(25(23-18)13(2)28)15-5-9-17(10-6-15)27(30)31/h3-10,19H,11,21H2,1-2H3 |
| InChIKey | OEQVROPVGXYRJC-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 141.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.42 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|