C25H23N3O3S — CID 71496104
ethyl 2,4-dimethyl-5-[(Z)-(4-oxo-3-phenyl-2-phenylimino-1,3-thiazolidin-5-ylidene)methyl]-1H-pyrrole-3-carboxylate (PubChem CID 71496104) has the molecular formula C25H23N3O3S and a molecular weight of 445.54 g/mol. Its IUPAC name is ethyl 2,4-dimethyl-5-[(Z)-(4-oxo-3-phenyl-2-phenylimino-1,3-thiazolidin-5-ylidene)methyl]-1H-pyrrole-3-carboxylate.
| Compound Name | ethyl 2,4-dimethyl-5-[(Z)-(4-oxo-3-phenyl-2-phenylimino-1,3-thiazolidin-5-ylidene)methyl]-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 71496104 |
| Molecular Formula | C25H23N3O3S |
| Molecular Weight | 445.54 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | ethyl 2,4-dimethyl-5-[(Z)-(4-oxo-3-phenyl-2-phenylimino-1,3-thiazolidin-5-ylidene)methyl]-1H-pyrrole-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)[nH]c(/C=C2\S/C(=N\c3ccccc3)N(c3ccccc3)C2=O)c1C |
| InChI | InChI=1S/C25H23N3O3S/c1-4-31-24(30)22-16(2)20(26-17(22)3)15-21-23(29)28(19-13-9-6-10-14-19)25(32-21)27-18-11-7-5-8-12-18/h5-15,26H,4H2,1-3H3/b21-15-,27-25- |
| InChIKey | JJXQQVDGVYWXJQ-USZFSVTMSA-N |
| XLogP | 5.62 |
| TPSA | 74.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.54 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_C(13)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|