C21H19N3O6 — CID 71496181
4-[[3-(3,4,5-trimethoxyphenyl)-1H-1,2,4-triazol-5-yl]methoxy]chromen-2-one (PubChem CID 71496181) has the molecular formula C21H19N3O6 and a molecular weight of 409.40 g/mol. Its IUPAC name is 4-[[3-(3,4,5-trimethoxyphenyl)-1H-1,2,4-triazol-5-yl]methoxy]chromen-2-one.
| Compound Name | 4-[[3-(3,4,5-trimethoxyphenyl)-1H-1,2,4-triazol-5-yl]methoxy]chromen-2-one |
|---|---|
| PubChem CID | 71496181 |
| Molecular Formula | C21H19N3O6 |
| Molecular Weight | 409.40 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | 4-[[3-(3,4,5-trimethoxyphenyl)-1H-1,2,4-triazol-5-yl]methoxy]chromen-2-one |
| SMILES | COc1cc(-c2n[nH]c(COc3cc(=O)oc4ccccc34)n2)cc(OC)c1OC |
| InChI | InChI=1S/C21H19N3O6/c1-26-16-8-12(9-17(27-2)20(16)28-3)21-22-18(23-24-21)11-29-15-10-19(25)30-14-7-5-4-6-13(14)15/h4-10H,11H2,1-3H3,(H,22,23,24) |
| InChIKey | YWHWPLXIOYPXID-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 108.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.40 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|