About 4-[(3-thiophen-2-yl-1H-1,2,4-triazol-5-yl)methoxy]chromen-2-one
4-[(3-thiophen-2-yl-1H-1,2,4-triazol-5-yl)methoxy]chromen-2-one (PubChem CID 71496184) has the molecular formula C16H11N3O3S
and a molecular weight of 325.35 g/mol. Its IUPAC name is 4-[(3-thiophen-2-yl-1H-1,2,4-triazol-5-yl)methoxy]chromen-2-one.
Molecular Properties
| Compound Name | 4-[(3-thiophen-2-yl-1H-1,2,4-triazol-5-yl)methoxy]chromen-2-one |
| PubChem CID | 71496184 |
| Molecular Formula | C16H11N3O3S |
| Molecular Weight | 325.35 g/mol |
| Exact Mass | 325.05 |
| IUPAC Name | 4-[(3-thiophen-2-yl-1H-1,2,4-triazol-5-yl)methoxy]chromen-2-one |
| SMILES | O=c1cc(OCc2nc(-c3cccs3)n[nH]2)c2ccccc2o1 |
| InChI | InChI=1S/C16H11N3O3S/c20-15-8-12(10-4-1-2-5-11(10)22-15)21-9-14-17-16(19-18-14)13-6-3-7-23-13/h1-8H,9H2,(H,17,18,19) |
| InChIKey | PQUINLAPDOMWTM-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 81.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.35 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 4-[(3-thiophen-2-yl-1H-1,2,4-triazol-5-yl)methoxy]chromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3-thiophen-2-yl-1H-1,2,4-triazol-5-yl)methoxy]chromen-2-one?
The IUPAC name of 4-[(3-thiophen-2-yl-1H-1,2,4-triazol-5-yl)methoxy]chromen-2-one (CID 71496184) is 4-[(3-thiophen-2-yl-1H-1,2,4-triazol-5-yl)methoxy]chromen-2-one.
What is the SMILES notation for 4-[(3-thiophen-2-yl-1H-1,2,4-triazol-5-yl)methoxy]chromen-2-one?
The canonical SMILES for 4-[(3-thiophen-2-yl-1H-1,2,4-triazol-5-yl)methoxy]chromen-2-one is O=c1cc(OCc2nc(-c3cccs3)n[nH]2)c2ccccc2o1.
What is the InChIKey of 4-[(3-thiophen-2-yl-1H-1,2,4-triazol-5-yl)methoxy]chromen-2-one?
The InChIKey is PQUINLAPDOMWTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11N3O3S/c20-15-8-12(10-4-1-2-5-11(10)22-15)21-9-14-17-16(19-18-14)13-6-3-7-23-13/h1-8H,9H2,(H,17,18,19).
What are the key properties of 4-[(3-thiophen-2-yl-1H-1,2,4-triazol-5-yl)methoxy]chromen-2-one?
4-[(3-thiophen-2-yl-1H-1,2,4-triazol-5-yl)methoxy]chromen-2-one has a molecular weight of 325.35 g/mol, XLogP of 3.22, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3-thiophen-2-yl-1H-1,2,4-triazol-5-yl)methoxy]chromen-2-one is sourced from PubChem (CID 71496184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).