C15H23N7O2 — CID 714962
(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)-propan-2-ylcyanamide (PubChem CID 714962) has the molecular formula C15H23N7O2 and a molecular weight of 333.40 g/mol. Its IUPAC name is (4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)-propan-2-ylcyanamide.
| Compound Name | (4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)-propan-2-ylcyanamide |
|---|---|
| PubChem CID | 714962 |
| Molecular Formula | C15H23N7O2 |
| Molecular Weight | 333.40 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | (4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)-propan-2-ylcyanamide |
| SMILES | CC(C)N(C#N)c1nc(N2CCOCC2)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C15H23N7O2/c1-12(2)22(11-16)15-18-13(20-3-7-23-8-4-20)17-14(19-15)21-5-9-24-10-6-21/h12H,3-10H2,1-2H3 |
| InChIKey | WRXRNPUCCPZFQH-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 90.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.40 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|