C25H28N4O — CID 71496723
2-[4-(azocan-1-yl)but-2-ynyl]-4,5-diphenyl-1,2,4-triazol-3-one (PubChem CID 71496723) has the molecular formula C25H28N4O and a molecular weight of 400.53 g/mol. Its IUPAC name is 2-[4-(azocan-1-yl)but-2-ynyl]-4,5-diphenyl-1,2,4-triazol-3-one.
| Compound Name | 2-[4-(azocan-1-yl)but-2-ynyl]-4,5-diphenyl-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 71496723 |
| Molecular Formula | C25H28N4O |
| Molecular Weight | 400.53 g/mol |
| Exact Mass | 400.23 |
| IUPAC Name | 2-[4-(azocan-1-yl)but-2-ynyl]-4,5-diphenyl-1,2,4-triazol-3-one |
| SMILES | O=c1n(CC#CCN2CCCCCCC2)nc(-c2ccccc2)n1-c1ccccc1 |
| InChI | InChI=1S/C25H28N4O/c30-25-28(21-13-12-20-27-18-10-2-1-3-11-19-27)26-24(22-14-6-4-7-15-22)29(25)23-16-8-5-9-17-23/h4-9,14-17H,1-3,10-11,18-21H2 |
| InChIKey | LURPBPPGTPOIAC-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 43.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.53 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|