C24H26N4O — CID 71496724
2-[4-(azepan-1-yl)but-2-ynyl]-4,5-diphenyl-1,2,4-triazol-3-one (PubChem CID 71496724) has the molecular formula C24H26N4O and a molecular weight of 386.50 g/mol. Its IUPAC name is 2-[4-(azepan-1-yl)but-2-ynyl]-4,5-diphenyl-1,2,4-triazol-3-one.
| Compound Name | 2-[4-(azepan-1-yl)but-2-ynyl]-4,5-diphenyl-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 71496724 |
| Molecular Formula | C24H26N4O |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | 2-[4-(azepan-1-yl)but-2-ynyl]-4,5-diphenyl-1,2,4-triazol-3-one |
| SMILES | O=c1n(CC#CCN2CCCCCC2)nc(-c2ccccc2)n1-c1ccccc1 |
| InChI | InChI=1S/C24H26N4O/c29-24-27(20-12-11-19-26-17-9-1-2-10-18-26)25-23(21-13-5-3-6-14-21)28(24)22-15-7-4-8-16-22/h3-8,13-16H,1-2,9-10,17-20H2 |
| InChIKey | SLFPNJKCCHNBKR-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 43.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|