C17H24O5 — CID 71496863
methyl (2Z)-2-[(1R,4S,7S,8R,10S)-1,4,8-triethyl-6-oxo-2,5-dioxatricyclo[5.2.1.04,10]decan-3-ylidene]acetate (PubChem CID 71496863) has the molecular formula C17H24O5 and a molecular weight of 308.37 g/mol. Its IUPAC name is methyl (2Z)-2-[(1R,4S,7S,8R,10S)-1,4,8-triethyl-6-oxo-2,5-dioxatricyclo[5.2.1.04,10]decan-3-ylidene]acetate.
| Compound Name | methyl (2Z)-2-[(1R,4S,7S,8R,10S)-1,4,8-triethyl-6-oxo-2,5-dioxatricyclo[5.2.1.04,10]decan-3-ylidene]acetate |
|---|---|
| PubChem CID | 71496863 |
| Molecular Formula | C17H24O5 |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | methyl (2Z)-2-[(1R,4S,7S,8R,10S)-1,4,8-triethyl-6-oxo-2,5-dioxatricyclo[5.2.1.04,10]decan-3-ylidene]acetate |
| SMILES | CC[C@@H]1C[C@@]2(CC)O/C(=C\C(=O)OC)[C@@]3(CC)OC(=O)[C@@H]1[C@@H]23 |
| InChI | InChI=1S/C17H24O5/c1-5-10-9-16(6-2)14-13(10)15(19)22-17(14,7-3)11(21-16)8-12(18)20-4/h8,10,13-14H,5-7,9H2,1-4H3/b11-8-/t10-,13+,14+,16-,17-/m1/s1 |
| InChIKey | KDYHKOBFPGRFTR-FQXDQGRQSA-N |
| XLogP | 2.59 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|