C16H26O3 — CID 71496867
(1R,4S,6S,7S,8R,10S)-1,4,6,8-tetraethyl-2,5-dioxatricyclo[5.2.1.04,10]decan-3-one (PubChem CID 71496867) has the molecular formula C16H26O3 and a molecular weight of 266.38 g/mol. Its IUPAC name is (1R,4S,6S,7S,8R,10S)-1,4,6,8-tetraethyl-2,5-dioxatricyclo[5.2.1.04,10]decan-3-one.
| Compound Name | (1R,4S,6S,7S,8R,10S)-1,4,6,8-tetraethyl-2,5-dioxatricyclo[5.2.1.04,10]decan-3-one |
|---|---|
| PubChem CID | 71496867 |
| Molecular Formula | C16H26O3 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | (1R,4S,6S,7S,8R,10S)-1,4,6,8-tetraethyl-2,5-dioxatricyclo[5.2.1.04,10]decan-3-one |
| SMILES | CC[C@@H]1C[C@@]2(CC)OC(=O)[C@@]3(CC)O[C@@H](CC)[C@@H]1[C@@H]23 |
| InChI | InChI=1S/C16H26O3/c1-5-10-9-15(7-3)13-12(10)11(6-2)18-16(13,8-4)14(17)19-15/h10-13H,5-9H2,1-4H3/t10-,11+,12-,13+,15-,16+/m1/s1 |
| InChIKey | DMLQORHBBIHBPA-NXNLJZTQSA-N |
| XLogP | 3.31 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |