About (4S)-3-benzyl-4-propyloxathiazolidine 2,2-dioxide
(4S)-3-benzyl-4-propyloxathiazolidine 2,2-dioxide (PubChem CID 71496893) has the molecular formula C12H17NO3S
and a molecular weight of 255.34 g/mol. Its IUPAC name is (4S)-3-benzyl-4-propyloxathiazolidine 2,2-dioxide.
Molecular Properties
| Compound Name | (4S)-3-benzyl-4-propyloxathiazolidine 2,2-dioxide |
| PubChem CID | 71496893 |
| Molecular Formula | C12H17NO3S |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | (4S)-3-benzyl-4-propyloxathiazolidine 2,2-dioxide |
| SMILES | CCC[C@H]1COS(=O)(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C12H17NO3S/c1-2-6-12-10-16-17(14,15)13(12)9-11-7-4-3-5-8-11/h3-5,7-8,12H,2,6,9-10H2,1H3/t12-/m0/s1 |
| InChIKey | FKKYPWPZNPQBSC-LBPRGKRZSA-N |
| XLogP | 1.93 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4S)-3-benzyl-4-propyloxathiazolidine 2,2-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-3-benzyl-4-propyloxathiazolidine 2,2-dioxide?
The IUPAC name of (4S)-3-benzyl-4-propyloxathiazolidine 2,2-dioxide (CID 71496893) is (4S)-3-benzyl-4-propyloxathiazolidine 2,2-dioxide.
What is the SMILES notation for (4S)-3-benzyl-4-propyloxathiazolidine 2,2-dioxide?
The canonical SMILES for (4S)-3-benzyl-4-propyloxathiazolidine 2,2-dioxide is CCC[C@H]1COS(=O)(=O)N1Cc1ccccc1.
What is the InChIKey of (4S)-3-benzyl-4-propyloxathiazolidine 2,2-dioxide?
The InChIKey is FKKYPWPZNPQBSC-LBPRGKRZSA-N. The full InChI is InChI=1S/C12H17NO3S/c1-2-6-12-10-16-17(14,15)13(12)9-11-7-4-3-5-8-11/h3-5,7-8,12H,2,6,9-10H2,1H3/t12-/m0/s1.
What are the key properties of (4S)-3-benzyl-4-propyloxathiazolidine 2,2-dioxide?
(4S)-3-benzyl-4-propyloxathiazolidine 2,2-dioxide has a molecular weight of 255.34 g/mol, XLogP of 1.93, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-3-benzyl-4-propyloxathiazolidine 2,2-dioxide is sourced from PubChem (CID 71496893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).