C34H49N — CID 71497770
(1S,14S,15S,18R,19R,22S,23R)-14,18-dimethyl-19-[(2R)-6-methylheptan-2-yl]-4-azahexacyclo[12.11.0.03,12.05,10.015,23.018,22]pentacosa-3,5,7,9,11-pentaene (PubChem CID 71497770) has the molecular formula C34H49N and a molecular weight of 471.77 g/mol. Its IUPAC name is (1S,14S,15S,18R,19R,22S,23R)-14,18-dimethyl-19-[(2R)-6-methylheptan-2-yl]-4-azahexacyclo[12.11.0.03,12.05,10.015,23.018,22]pentacosa-3,5,7,9,11-pentaene.
| Compound Name | (1S,14S,15S,18R,19R,22S,23R)-14,18-dimethyl-19-[(2R)-6-methylheptan-2-yl]-4-azahexacyclo[12.11.0.03,12.05,10.015,23.018,22]pentacosa-3,5,7,9,11-pentaene |
|---|---|
| PubChem CID | 71497770 |
| Molecular Formula | C34H49N |
| Molecular Weight | 471.77 g/mol |
| Exact Mass | 471.39 |
| IUPAC Name | (1S,14S,15S,18R,19R,22S,23R)-14,18-dimethyl-19-[(2R)-6-methylheptan-2-yl]-4-azahexacyclo[12.11.0.03,12.05,10.015,23.018,22]pentacosa-3,5,7,9,11-pentaene |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC[C@H]4Cc5nc6ccccc6cc5C[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C34H49N/c1-22(2)9-8-10-23(3)28-15-16-29-27-14-13-26-20-32-25(19-24-11-6-7-12-31(24)35-32)21-34(26,5)30(27)17-18-33(28,29)4/h6-7,11-12,19,22-23,26-30H,8-10,13-18,20-21H2,1-5H3/t23-,26+,27+,28-,29+,30+,33-,34+/m1/s1 |
| InChIKey | JIZWXFQBGPQANX-XSLJFIDMSA-N |
| XLogP | 9.27 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.77 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |