C35H51N — CID 71497771
(1S,14S,15S,18R,19R,22S,23R)-8,14,18-trimethyl-19-[(2R)-6-methylheptan-2-yl]-4-azahexacyclo[12.11.0.03,12.05,10.015,23.018,22]pentacosa-3(12),4,6,8,10-pentaene (PubChem CID 71497771) has the molecular formula C35H51N and a molecular weight of 485.80 g/mol. Its IUPAC name is (1S,14S,15S,18R,19R,22S,23R)-8,14,18-trimethyl-19-[(2R)-6-methylheptan-2-yl]-4-azahexacyclo[12.11.0.03,12.05,10.015,23.018,22]pentacosa-3(12),4,6,8,10-pentaene.
| Compound Name | (1S,14S,15S,18R,19R,22S,23R)-8,14,18-trimethyl-19-[(2R)-6-methylheptan-2-yl]-4-azahexacyclo[12.11.0.03,12.05,10.015,23.018,22]pentacosa-3(12),4,6,8,10-pentaene |
|---|---|
| PubChem CID | 71497771 |
| Molecular Formula | C35H51N |
| Molecular Weight | 485.80 g/mol |
| Exact Mass | 485.40 |
| IUPAC Name | (1S,14S,15S,18R,19R,22S,23R)-8,14,18-trimethyl-19-[(2R)-6-methylheptan-2-yl]-4-azahexacyclo[12.11.0.03,12.05,10.015,23.018,22]pentacosa-3(12),4,6,8,10-pentaene |
| SMILES | Cc1ccc2nc3c(cc2c1)C[C@@]1(C)[C@@H](CC[C@@H]2[C@@H]1CC[C@]1(C)[C@@H]([C@H](C)CCCC(C)C)CC[C@@H]21)C3 |
| InChI | InChI=1S/C35H51N/c1-22(2)8-7-9-24(4)29-13-14-30-28-12-11-27-20-33-26(19-25-18-23(3)10-15-32(25)36-33)21-35(27,6)31(28)16-17-34(29,30)5/h10,15,18-19,22,24,27-31H,7-9,11-14,16-17,20-21H2,1-6H3/t24-,27+,28+,29-,30+,31+,34-,35+/m1/s1 |
| InChIKey | BCWMYCXONOREBA-HQNAAZPLSA-N |
| XLogP | 9.58 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.80 |
| LogP ≤ 5 | 9.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |