C34H48BrN — CID 71497773
(1S,14S,15S,18R,19R,22S,23R)-8-bromo-14,18-dimethyl-19-[(2R)-6-methylheptan-2-yl]-4-azahexacyclo[12.11.0.03,12.05,10.015,23.018,22]pentacosa-3(12),4,6,8,10-pentaene (PubChem CID 71497773) has the molecular formula C34H48BrN and a molecular weight of 550.67 g/mol. Its IUPAC name is (1S,14S,15S,18R,19R,22S,23R)-8-bromo-14,18-dimethyl-19-[(2R)-6-methylheptan-2-yl]-4-azahexacyclo[12.11.0.03,12.05,10.015,23.018,22]pentacosa-3(12),4,6,8,10-pentaene.
| Compound Name | (1S,14S,15S,18R,19R,22S,23R)-8-bromo-14,18-dimethyl-19-[(2R)-6-methylheptan-2-yl]-4-azahexacyclo[12.11.0.03,12.05,10.015,23.018,22]pentacosa-3(12),4,6,8,10-pentaene |
|---|---|
| PubChem CID | 71497773 |
| Molecular Formula | C34H48BrN |
| Molecular Weight | 550.67 g/mol |
| Exact Mass | 549.30 |
| IUPAC Name | (1S,14S,15S,18R,19R,22S,23R)-8-bromo-14,18-dimethyl-19-[(2R)-6-methylheptan-2-yl]-4-azahexacyclo[12.11.0.03,12.05,10.015,23.018,22]pentacosa-3(12),4,6,8,10-pentaene |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC[C@H]4Cc5nc6ccc(Br)cc6cc5C[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C34H48BrN/c1-21(2)7-6-8-22(3)28-12-13-29-27-11-9-25-19-32-24(17-23-18-26(35)10-14-31(23)36-32)20-34(25,5)30(27)15-16-33(28,29)4/h10,14,17-18,21-22,25,27-30H,6-9,11-13,15-16,19-20H2,1-5H3/t22-,25+,27+,28-,29+,30+,33-,34+/m1/s1 |
| InChIKey | JLKPXCIIPUTJKW-CGXURYAZSA-N |
| XLogP | 10.03 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.67 |
| LogP ≤ 5 | 10.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |