C38H51N — CID 71497853
(3S,4S,7R,8R,11S,12R,15S)-3,7-dimethyl-8-[(2R)-6-methylheptan-2-yl]-18-azaheptacyclo[15.12.0.03,15.04,12.07,11.019,28.021,26]nonacosa-1(29),17,19,21,23,25,27-heptaene (PubChem CID 71497853) has the molecular formula C38H51N and a molecular weight of 521.83 g/mol. Its IUPAC name is (3S,4S,7R,8R,11S,12R,15S)-3,7-dimethyl-8-[(2R)-6-methylheptan-2-yl]-18-azaheptacyclo[15.12.0.03,15.04,12.07,11.019,28.021,26]nonacosa-1(29),17,19,21,23,25,27-heptaene.
| Compound Name | (3S,4S,7R,8R,11S,12R,15S)-3,7-dimethyl-8-[(2R)-6-methylheptan-2-yl]-18-azaheptacyclo[15.12.0.03,15.04,12.07,11.019,28.021,26]nonacosa-1(29),17,19,21,23,25,27-heptaene |
|---|---|
| PubChem CID | 71497853 |
| Molecular Formula | C38H51N |
| Molecular Weight | 521.83 g/mol |
| Exact Mass | 521.40 |
| IUPAC Name | (3S,4S,7R,8R,11S,12R,15S)-3,7-dimethyl-8-[(2R)-6-methylheptan-2-yl]-18-azaheptacyclo[15.12.0.03,15.04,12.07,11.019,28.021,26]nonacosa-1(29),17,19,21,23,25,27-heptaene |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC[C@H]4Cc5nc6cc7ccccc7cc6cc5C[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C38H51N/c1-24(2)9-8-10-25(3)32-15-16-33-31-14-13-30-22-36-29(23-38(30,5)34(31)17-18-37(32,33)4)20-28-19-26-11-6-7-12-27(26)21-35(28)39-36/h6-7,11-12,19-21,24-25,30-34H,8-10,13-18,22-23H2,1-5H3/t25-,30+,31+,32-,33+,34+,37-,38+/m1/s1 |
| InChIKey | NOKWHLWQUHOSKO-QGNVLJOCSA-N |
| XLogP | 10.42 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.83 |
| LogP ≤ 5 | 10.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|