C22H20N4O3 — CID 71498299
(4E)-4-[hydroxy(phenyl)methylidene]-1-[3-(1H-imidazol-2-yl)propyl]-5-pyridin-2-ylpyrrolidine-2,3-dione (PubChem CID 71498299) has the molecular formula C22H20N4O3 and a molecular weight of 388.43 g/mol. Its IUPAC name is (4E)-4-[hydroxy(phenyl)methylidene]-1-[3-(1H-imidazol-2-yl)propyl]-5-pyridin-2-ylpyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[hydroxy(phenyl)methylidene]-1-[3-(1H-imidazol-2-yl)propyl]-5-pyridin-2-ylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 71498299 |
| Molecular Formula | C22H20N4O3 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | (4E)-4-[hydroxy(phenyl)methylidene]-1-[3-(1H-imidazol-2-yl)propyl]-5-pyridin-2-ylpyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(CCCc2ncc[nH]2)C(c2ccccn2)/C1=C(\O)c1ccccc1 |
| InChI | InChI=1S/C22H20N4O3/c27-20(15-7-2-1-3-8-15)18-19(16-9-4-5-11-23-16)26(22(29)21(18)28)14-6-10-17-24-12-13-25-17/h1-5,7-9,11-13,19,27H,6,10,14H2,(H,24,25)/b20-18+ |
| InChIKey | ZVURWLCTANVQKW-CZIZESTLSA-N |
| XLogP | 2.86 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|