C18H32OS — CID 71498343
3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropan-1-ol (PubChem CID 71498343) has the molecular formula C18H32OS and a molecular weight of 296.52 g/mol. Its IUPAC name is 3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropan-1-ol.
| Compound Name | 3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropan-1-ol |
|---|---|
| PubChem CID | 71498343 |
| Molecular Formula | C18H32OS |
| Molecular Weight | 296.52 g/mol |
| Exact Mass | 296.22 |
| IUPAC Name | 3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropan-1-ol |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CSCCCO |
| InChI | InChI=1S/C18H32OS/c1-16(2)8-5-9-17(3)10-6-11-18(4)12-15-20-14-7-13-19/h8,10,12,19H,5-7,9,11,13-15H2,1-4H3/b17-10+,18-12+ |
| InChIKey | DKBMVBMOTWSYDY-VZRGJMDUSA-N |
| XLogP | 5.52 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.52 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|