C18H30O2S — CID 71498382
methyl 2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylacetate (PubChem CID 71498382) has the molecular formula C18H30O2S and a molecular weight of 310.50 g/mol. Its IUPAC name is methyl 2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylacetate.
| Compound Name | methyl 2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylacetate |
|---|---|
| PubChem CID | 71498382 |
| Molecular Formula | C18H30O2S |
| Molecular Weight | 310.50 g/mol |
| Exact Mass | 310.20 |
| IUPAC Name | methyl 2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylacetate |
| SMILES | COC(=O)CSC/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C18H30O2S/c1-15(2)8-6-9-16(3)10-7-11-17(4)12-13-21-14-18(19)20-5/h8,10,12H,6-7,9,11,13-14H2,1-5H3/b16-10+,17-12+ |
| InChIKey | AKQKAXLSCCBADJ-JTCWOHKRSA-N |
| XLogP | 5.31 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.50 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|