C19H32O2S — CID 71498386
2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylethyl acetate (PubChem CID 71498386) has the molecular formula C19H32O2S and a molecular weight of 324.53 g/mol. Its IUPAC name is 2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylethyl acetate.
| Compound Name | 2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylethyl acetate |
|---|---|
| PubChem CID | 71498386 |
| Molecular Formula | C19H32O2S |
| Molecular Weight | 324.53 g/mol |
| Exact Mass | 324.21 |
| IUPAC Name | 2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylethyl acetate |
| SMILES | CC(=O)OCCSC/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C19H32O2S/c1-16(2)8-6-9-17(3)10-7-11-18(4)12-14-22-15-13-21-19(5)20/h8,10,12H,6-7,9,11,13-15H2,1-5H3/b17-10+,18-12+ |
| InChIKey | PNNVLERBFBPMAV-VZRGJMDUSA-N |
| XLogP | 5.70 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.53 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|