C18H32S — CID 71498424
(2E,6E)-3,7,11-trimethyl-1-propan-2-ylsulfanyldodeca-2,6,10-triene (PubChem CID 71498424) has the molecular formula C18H32S and a molecular weight of 280.52 g/mol. Its IUPAC name is (2E,6E)-3,7,11-trimethyl-1-propan-2-ylsulfanyldodeca-2,6,10-triene.
| Compound Name | (2E,6E)-3,7,11-trimethyl-1-propan-2-ylsulfanyldodeca-2,6,10-triene |
|---|---|
| PubChem CID | 71498424 |
| Molecular Formula | C18H32S |
| Molecular Weight | 280.52 g/mol |
| Exact Mass | 280.22 |
| IUPAC Name | (2E,6E)-3,7,11-trimethyl-1-propan-2-ylsulfanyldodeca-2,6,10-triene |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CSC(C)C |
| InChI | InChI=1S/C18H32S/c1-15(2)9-7-10-17(5)11-8-12-18(6)13-14-19-16(3)4/h9,11,13,16H,7-8,10,12,14H2,1-6H3/b17-11+,18-13+ |
| InChIKey | GJJMHHPUOXKXLF-OUBUNXTGSA-N |
| XLogP | 6.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.52 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|