C17H30S2 — CID 71498426
2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylethanethiol (PubChem CID 71498426) has the molecular formula C17H30S2 and a molecular weight of 298.56 g/mol. Its IUPAC name is 2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylethanethiol.
| Compound Name | 2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylethanethiol |
|---|---|
| PubChem CID | 71498426 |
| Molecular Formula | C17H30S2 |
| Molecular Weight | 298.56 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | 2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylethanethiol |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CSCCS |
| InChI | InChI=1S/C17H30S2/c1-15(2)7-5-8-16(3)9-6-10-17(4)11-13-19-14-12-18/h7,9,11,18H,5-6,8,10,12-14H2,1-4H3/b16-9+,17-11+ |
| InChIKey | JDYJUJOXUYAFGE-BTMZFSHUSA-N |
| XLogP | 6.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.56 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|