C20H34O2S — CID 71498461
methyl 2-methyl-2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoate (PubChem CID 71498461) has the molecular formula C20H34O2S and a molecular weight of 338.56 g/mol. Its IUPAC name is methyl 2-methyl-2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoate.
| Compound Name | methyl 2-methyl-2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoate |
|---|---|
| PubChem CID | 71498461 |
| Molecular Formula | C20H34O2S |
| Molecular Weight | 338.56 g/mol |
| Exact Mass | 338.23 |
| IUPAC Name | methyl 2-methyl-2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoate |
| SMILES | COC(=O)C(C)(C)SC/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C20H34O2S/c1-16(2)10-8-11-17(3)12-9-13-18(4)14-15-23-20(5,6)19(21)22-7/h10,12,14H,8-9,11,13,15H2,1-7H3/b17-12+,18-14+ |
| InChIKey | RWPTYUPMHIBTGU-NXGXIAAHSA-N |
| XLogP | 6.09 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.56 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|