C20H35NO2S — CID 71498462
ethyl N-[2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylethyl]carbamate (PubChem CID 71498462) has the molecular formula C20H35NO2S and a molecular weight of 353.57 g/mol. Its IUPAC name is ethyl N-[2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylethyl]carbamate.
| Compound Name | ethyl N-[2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylethyl]carbamate |
|---|---|
| PubChem CID | 71498462 |
| Molecular Formula | C20H35NO2S |
| Molecular Weight | 353.57 g/mol |
| Exact Mass | 353.24 |
| IUPAC Name | ethyl N-[2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylethyl]carbamate |
| SMILES | CCOC(=O)NCCSC/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C20H35NO2S/c1-6-23-20(22)21-14-16-24-15-13-19(5)12-8-11-18(4)10-7-9-17(2)3/h9,11,13H,6-8,10,12,14-16H2,1-5H3,(H,21,22)/b18-11+,19-13+ |
| InChIKey | ABBMATXNEBQOKJ-NWLVNBMCSA-N |
| XLogP | 5.88 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.57 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|