C19H32O2S — CID 71498463
2-methyl-2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid (PubChem CID 71498463) has the molecular formula C19H32O2S and a molecular weight of 324.53 g/mol. Its IUPAC name is 2-methyl-2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid.
| Compound Name | 2-methyl-2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 71498463 |
| Molecular Formula | C19H32O2S |
| Molecular Weight | 324.53 g/mol |
| Exact Mass | 324.21 |
| IUPAC Name | 2-methyl-2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CSC(C)(C)C(=O)O |
| InChI | InChI=1S/C19H32O2S/c1-15(2)9-7-10-16(3)11-8-12-17(4)13-14-22-19(5,6)18(20)21/h9,11,13H,7-8,10,12,14H2,1-6H3,(H,20,21)/b16-11+,17-13+ |
| InChIKey | VYVMTMRSNNFHJT-IUBLYSDUSA-N |
| XLogP | 6.00 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.53 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|