C19H34OS — CID 71498464
2-methyl-2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropan-1-ol (PubChem CID 71498464) has the molecular formula C19H34OS and a molecular weight of 310.55 g/mol. Its IUPAC name is 2-methyl-2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropan-1-ol.
| Compound Name | 2-methyl-2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropan-1-ol |
|---|---|
| PubChem CID | 71498464 |
| Molecular Formula | C19H34OS |
| Molecular Weight | 310.55 g/mol |
| Exact Mass | 310.23 |
| IUPAC Name | 2-methyl-2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropan-1-ol |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CSC(C)(C)CO |
| InChI | InChI=1S/C19H34OS/c1-16(2)9-7-10-17(3)11-8-12-18(4)13-14-21-19(5,6)15-20/h9,11,13,20H,7-8,10,12,14-15H2,1-6H3/b17-11+,18-13+ |
| InChIKey | BMFFGHJNOJGRSF-OUBUNXTGSA-N |
| XLogP | 5.91 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.55 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|